C28H28FNO6 — CID 29048920
6-O-methyl 3-O-(2-phenoxyethyl) (4R,6S,7S)-4-(3-fluorophenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 29048920) has the molecular formula C28H28FNO6 and a molecular weight of 493.53 g/mol. Its IUPAC name is 6-O-methyl 3-O-(2-phenoxyethyl) (4R,6S,7S)-4-(3-fluorophenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | 6-O-methyl 3-O-(2-phenoxyethyl) (4R,6S,7S)-4-(3-fluorophenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 29048920 |
| Molecular Formula | C28H28FNO6 |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | 6-O-methyl 3-O-(2-phenoxyethyl) (4R,6S,7S)-4-(3-fluorophenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)C2=C(C[C@@H]1C)NC(C)=C(C(=O)OCCOc1ccccc1)[C@@H]2c1cccc(F)c1 |
| InChI | InChI=1S/C28H28FNO6/c1-16-14-21-25(26(31)22(16)27(32)34-3)24(18-8-7-9-19(29)15-18)23(17(2)30-21)28(33)36-13-12-35-20-10-5-4-6-11-20/h4-11,15-16,22,24,30H,12-14H2,1-3H3/t16-,22-,24-/m0/s1 |
| InChIKey | VWPJANHYJJQFSP-DQLWACAZSA-N |
| XLogP | 4.06 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|