C28H28FNO6 — CID 6559526
3-O-[(4-methoxyphenyl)methyl] 6-O-methyl (4R,6S,7R)-4-(3-fluorophenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate (PubChem CID 6559526) has the molecular formula C28H28FNO6 and a molecular weight of 493.53 g/mol. Its IUPAC name is 3-O-[(4-methoxyphenyl)methyl] 6-O-methyl (4R,6S,7R)-4-(3-fluorophenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate.
| Compound Name | 3-O-[(4-methoxyphenyl)methyl] 6-O-methyl (4R,6S,7R)-4-(3-fluorophenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
|---|---|
| PubChem CID | 6559526 |
| Molecular Formula | C28H28FNO6 |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | 3-O-[(4-methoxyphenyl)methyl] 6-O-methyl (4R,6S,7R)-4-(3-fluorophenyl)-2,7-dimethyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3,6-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C(=O)C2=C(C[C@H]1C)NC(C)=C(C(=O)OCc1ccc(OC)cc1)[C@@H]2c1cccc(F)c1 |
| InChI | InChI=1S/C28H28FNO6/c1-15-12-21-25(26(31)22(15)27(32)35-4)24(18-6-5-7-19(29)13-18)23(16(2)30-21)28(33)36-14-17-8-10-20(34-3)11-9-17/h5-11,13,15,22,24,30H,12,14H2,1-4H3/t15-,22+,24+/m1/s1 |
| InChIKey | JOASUGIRDJWOAK-LIAVLPADSA-N |
| XLogP | 4.19 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|