C15H17Br2N3O3S2 — CID 29050252
methyl 2-[[[(1R)-2,2-dibromo-1-methylcyclopropanecarbonyl]amino]carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 29050252) has the molecular formula C15H17Br2N3O3S2 and a molecular weight of 511.26 g/mol. Its IUPAC name is methyl 2-[[[(1R)-2,2-dibromo-1-methylcyclopropanecarbonyl]amino]carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[[(1R)-2,2-dibromo-1-methylcyclopropanecarbonyl]amino]carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 29050252 |
| Molecular Formula | C15H17Br2N3O3S2 |
| Molecular Weight | 511.26 g/mol |
| Exact Mass | 508.91 |
| IUPAC Name | methyl 2-[[[(1R)-2,2-dibromo-1-methylcyclopropanecarbonyl]amino]carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)NNC(=O)[C@@]2(C)CC2(Br)Br)sc2c1CCC2 |
| InChI | InChI=1S/C15H17Br2N3O3S2/c1-14(6-15(14,16)17)12(22)19-20-13(24)18-10-9(11(21)23-2)7-4-3-5-8(7)25-10/h3-6H2,1-2H3,(H,19,22)(H2,18,20,24)/t14-/m1/s1 |
| InChIKey | DRILPAWWQOFRGI-CQSZACIVSA-N |
| XLogP | 3.24 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|