C20H31N3O3S2 — CID 4508590
methyl 2-[(decanoylamino)carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 4508590) has the molecular formula C20H31N3O3S2 and a molecular weight of 425.62 g/mol. Its IUPAC name is methyl 2-[(decanoylamino)carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[(decanoylamino)carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4508590 |
| Molecular Formula | C20H31N3O3S2 |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | methyl 2-[(decanoylamino)carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | CCCCCCCCCC(=O)NNC(=S)Nc1sc2c(c1C(=O)OC)CCC2 |
| InChI | InChI=1S/C20H31N3O3S2/c1-3-4-5-6-7-8-9-13-16(24)22-23-20(27)21-18-17(19(25)26-2)14-11-10-12-15(14)28-18/h3-13H2,1-2H3,(H,22,24)(H2,21,23,27) |
| InChIKey | ZFWSOIWLJDQHCD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|