C24H21N3O4S — CID 29055752
(4S)-5-acetyl-2-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]-4-(furan-2-yl)-6-methyl-1,4-dihydropyridine-3-carbonitrile (PubChem CID 29055752) has the molecular formula C24H21N3O4S and a molecular weight of 447.52 g/mol. Its IUPAC name is (4S)-5-acetyl-2-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]-4-(furan-2-yl)-6-methyl-1,4-dihydropyridine-3-carbonitrile.
| Compound Name | (4S)-5-acetyl-2-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]-4-(furan-2-yl)-6-methyl-1,4-dihydropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 29055752 |
| Molecular Formula | C24H21N3O4S |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | (4S)-5-acetyl-2-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]-4-(furan-2-yl)-6-methyl-1,4-dihydropyridine-3-carbonitrile |
| SMILES | CC(=O)C1=C(C)NC(SCCCN2C(=O)c3ccccc3C2=O)=C(C#N)[C@H]1c1ccco1 |
| InChI | InChI=1S/C24H21N3O4S/c1-14-20(15(2)28)21(19-9-5-11-31-19)18(13-25)22(26-14)32-12-6-10-27-23(29)16-7-3-4-8-17(16)24(27)30/h3-5,7-9,11,21,26H,6,10,12H2,1-2H3/t21-/m0/s1 |
| InChIKey | WIKUOWNZPFBPLA-NRFANRHFSA-N |
| XLogP | 3.98 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|