C12H10Br2N2O2S — CID 29063655
2-[1-(2,6-dibromo-4-methylphenyl)imidazol-2-yl]sulfanylacetic acid (PubChem CID 29063655) has the molecular formula C12H10Br2N2O2S and a molecular weight of 406.10 g/mol. Its IUPAC name is 2-[1-(2,6-dibromo-4-methylphenyl)imidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[1-(2,6-dibromo-4-methylphenyl)imidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 29063655 |
| Molecular Formula | C12H10Br2N2O2S |
| Molecular Weight | 406.10 g/mol |
| Exact Mass | 403.88 |
| IUPAC Name | 2-[1-(2,6-dibromo-4-methylphenyl)imidazol-2-yl]sulfanylacetic acid |
| SMILES | Cc1cc(Br)c(-n2ccnc2SCC(=O)O)c(Br)c1 |
| InChI | InChI=1S/C12H10Br2N2O2S/c1-7-4-8(13)11(9(14)5-7)16-3-2-15-12(16)19-6-10(17)18/h2-5H,6H2,1H3,(H,17,18) |
| InChIKey | OLAASKXKJFUDPM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.10 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |