C21H34N2O5 — CID 2906531
ethyl 4-[3-(2-tert-butyl-4-methoxyphenoxy)-2-hydroxypropyl]piperazine-1-carboxylate (PubChem CID 2906531) has the molecular formula C21H34N2O5 and a molecular weight of 394.51 g/mol. Its IUPAC name is ethyl 4-[3-(2-tert-butyl-4-methoxyphenoxy)-2-hydroxypropyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-(2-tert-butyl-4-methoxyphenoxy)-2-hydroxypropyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 2906531 |
| Molecular Formula | C21H34N2O5 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | ethyl 4-[3-(2-tert-butyl-4-methoxyphenoxy)-2-hydroxypropyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(CC(O)COc2ccc(OC)cc2C(C)(C)C)CC1 |
| InChI | InChI=1S/C21H34N2O5/c1-6-27-20(25)23-11-9-22(10-12-23)14-16(24)15-28-19-8-7-17(26-5)13-18(19)21(2,3)4/h7-8,13,16,24H,6,9-12,14-15H2,1-5H3 |
| InChIKey | UTLRJQAYMIBHKS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |