C21H19ClF2N4O4S — CID 29071916
2-chloro-N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-5-nitrobenzamide (PubChem CID 29071916) has the molecular formula C21H19ClF2N4O4S and a molecular weight of 496.92 g/mol. Its IUPAC name is 2-chloro-N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-5-nitrobenzamide.
| Compound Name | 2-chloro-N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 29071916 |
| Molecular Formula | C21H19ClF2N4O4S |
| Molecular Weight | 496.92 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | 2-chloro-N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-(3-morpholin-4-ylpropyl)-5-nitrobenzamide |
| SMILES | O=C(c1cc([N+](=O)[O-])ccc1Cl)N(CCCN1CCOCC1)c1nc2c(F)cc(F)cc2s1 |
| InChI | InChI=1S/C21H19ClF2N4O4S/c22-16-3-2-14(28(30)31)12-15(16)20(29)27(5-1-4-26-6-8-32-9-7-26)21-25-19-17(24)10-13(23)11-18(19)33-21/h2-3,10-12H,1,4-9H2 |
| InChIKey | WLMQCUVRATVHCI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.92 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|