C9H7F2N3S — CID 29072958
4-(3,4-difluorophenyl)-3-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 29072958) has the molecular formula C9H7F2N3S and a molecular weight of 227.24 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-3-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(3,4-difluorophenyl)-3-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 29072958 |
| Molecular Formula | C9H7F2N3S |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 4-(3,4-difluorophenyl)-3-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1n[nH]c(=S)n1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C9H7F2N3S/c1-5-12-13-9(15)14(5)6-2-3-7(10)8(11)4-6/h2-4H,1H3,(H,13,15) |
| InChIKey | CQQGPEVTJLISQW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|