C15H14N4S — CID 29080
4-(1,3-benzothiazol-6-yldiazenyl)-N,N-dimethylaniline (PubChem CID 29080) has the molecular formula C15H14N4S and a molecular weight of 282.37 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-6-yldiazenyl)-N,N-dimethylaniline.
| Compound Name | 4-(1,3-benzothiazol-6-yldiazenyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 29080 |
| Molecular Formula | C15H14N4S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 4-(1,3-benzothiazol-6-yldiazenyl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/N=N/c2ccc3ncsc3c2)cc1 |
| InChI | InChI=1S/C15H14N4S/c1-19(2)13-6-3-11(4-7-13)17-18-12-5-8-14-15(9-12)20-10-16-14/h3-10H,1-2H3/b18-17+ |
| InChIKey | RRPLFUWADFBRTK-ISLYRVAYSA-N |
| XLogP | 4.78 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|