C14H13Cl2NO — CID 2908463
2-[(2,3-dichlorophenyl)methylidene]-1-azabicyclo[2.2.2]octan-3-one (PubChem CID 2908463) has the molecular formula C14H13Cl2NO and a molecular weight of 282.17 g/mol. Its IUPAC name is 2-[(2,3-dichlorophenyl)methylidene]-1-azabicyclo[2.2.2]octan-3-one.
| Compound Name | 2-[(2,3-dichlorophenyl)methylidene]-1-azabicyclo[2.2.2]octan-3-one |
|---|---|
| PubChem CID | 2908463 |
| Molecular Formula | C14H13Cl2NO |
| Molecular Weight | 282.17 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 2-[(2,3-dichlorophenyl)methylidene]-1-azabicyclo[2.2.2]octan-3-one |
| SMILES | O=C1C(=Cc2cccc(Cl)c2Cl)N2CCC1CC2 |
| InChI | InChI=1S/C14H13Cl2NO/c15-11-3-1-2-10(13(11)16)8-12-14(18)9-4-6-17(12)7-5-9/h1-3,8-9H,4-7H2 |
| InChIKey | FDHVPIOJIPGSCQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.17 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|