C24H39ClN4O2 — CID 29087455
3-[(3S,4R)-1-[(4-chlorophenyl)methyl]-4-morpholin-4-ylpiperidin-3-yl]-N-[3-(dimethylamino)propyl]propanamide (PubChem CID 29087455) has the molecular formula C24H39ClN4O2 and a molecular weight of 451.06 g/mol. Its IUPAC name is 3-[(3S,4R)-1-[(4-chlorophenyl)methyl]-4-morpholin-4-ylpiperidin-3-yl]-N-[3-(dimethylamino)propyl]propanamide.
| Compound Name | 3-[(3S,4R)-1-[(4-chlorophenyl)methyl]-4-morpholin-4-ylpiperidin-3-yl]-N-[3-(dimethylamino)propyl]propanamide |
|---|---|
| PubChem CID | 29087455 |
| Molecular Formula | C24H39ClN4O2 |
| Molecular Weight | 451.06 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | 3-[(3S,4R)-1-[(4-chlorophenyl)methyl]-4-morpholin-4-ylpiperidin-3-yl]-N-[3-(dimethylamino)propyl]propanamide |
| SMILES | CN(C)CCCNC(=O)CC[C@H]1CN(Cc2ccc(Cl)cc2)CC[C@H]1N1CCOCC1 |
| InChI | InChI=1S/C24H39ClN4O2/c1-27(2)12-3-11-26-24(30)9-6-21-19-28(18-20-4-7-22(25)8-5-20)13-10-23(21)29-14-16-31-17-15-29/h4-5,7-8,21,23H,3,6,9-19H2,1-2H3,(H,26,30)/t21-,23+/m0/s1 |
| InChIKey | UEYDFSGQQCQAGF-JTHBVZDNSA-N |
| XLogP | 2.71 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.06 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|