C18H25N5O2S — CID 29088094
N-cyclopropyl-5-methyl-4-(3-morpholin-4-ylpropylamino)thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 29088094) has the molecular formula C18H25N5O2S and a molecular weight of 375.50 g/mol. Its IUPAC name is N-cyclopropyl-5-methyl-4-(3-morpholin-4-ylpropylamino)thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-cyclopropyl-5-methyl-4-(3-morpholin-4-ylpropylamino)thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 29088094 |
| Molecular Formula | C18H25N5O2S |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | N-cyclopropyl-5-methyl-4-(3-morpholin-4-ylpropylamino)thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1c(C(=O)NC2CC2)sc2ncnc(NCCCN3CCOCC3)c12 |
| InChI | InChI=1S/C18H25N5O2S/c1-12-14-16(19-5-2-6-23-7-9-25-10-8-23)20-11-21-18(14)26-15(12)17(24)22-13-3-4-13/h11,13H,2-10H2,1H3,(H,22,24)(H,19,20,21) |
| InChIKey | GCTSYKLQKVYOGJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|