C22H31N5O2S — CID 42189852
N-cycloheptyl-5-methyl-4-[3-(2-oxopyrrolidin-1-yl)propylamino]thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 42189852) has the molecular formula C22H31N5O2S and a molecular weight of 429.59 g/mol. Its IUPAC name is N-cycloheptyl-5-methyl-4-[3-(2-oxopyrrolidin-1-yl)propylamino]thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-cycloheptyl-5-methyl-4-[3-(2-oxopyrrolidin-1-yl)propylamino]thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 42189852 |
| Molecular Formula | C22H31N5O2S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | N-cycloheptyl-5-methyl-4-[3-(2-oxopyrrolidin-1-yl)propylamino]thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1c(C(=O)NC2CCCCCC2)sc2ncnc(NCCCN3CCCC3=O)c12 |
| InChI | InChI=1S/C22H31N5O2S/c1-15-18-20(23-11-7-13-27-12-6-10-17(27)28)24-14-25-22(18)30-19(15)21(29)26-16-8-4-2-3-5-9-16/h14,16H,2-13H2,1H3,(H,26,29)(H,23,24,25) |
| InChIKey | ZUGUCKDJPQUXND-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|