C17H24N4O2S — CID 28851124
cyclohexyl 4-(3-aminopropylamino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 28851124) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is cyclohexyl 4-(3-aminopropylamino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | cyclohexyl 4-(3-aminopropylamino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 28851124 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | cyclohexyl 4-(3-aminopropylamino)-5-methylthieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | Cc1c(C(=O)OC2CCCCC2)sc2ncnc(NCCCN)c12 |
| InChI | InChI=1S/C17H24N4O2S/c1-11-13-15(19-9-5-8-18)20-10-21-16(13)24-14(11)17(22)23-12-6-3-2-4-7-12/h10,12H,2-9,18H2,1H3,(H,19,20,21) |
| InChIKey | VNNJNEVQBKQTDT-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|