C20H22AsN3O5S — CID 112501335
[4-[(6-cyclohexyloxycarbonyl-5-methylthieno[2,3-d]pyrimidin-4-yl)amino]phenyl]arsonic acid (PubChem CID 112501335) has the molecular formula C20H22AsN3O5S and a molecular weight of 491.40 g/mol. Its IUPAC name is [4-[(6-cyclohexyloxycarbonyl-5-methylthieno[2,3-d]pyrimidin-4-yl)amino]phenyl]arsonic acid.
| Compound Name | [4-[(6-cyclohexyloxycarbonyl-5-methylthieno[2,3-d]pyrimidin-4-yl)amino]phenyl]arsonic acid |
|---|---|
| PubChem CID | 112501335 |
| Molecular Formula | C20H22AsN3O5S |
| Molecular Weight | 491.40 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | [4-[(6-cyclohexyloxycarbonyl-5-methylthieno[2,3-d]pyrimidin-4-yl)amino]phenyl]arsonic acid |
| SMILES | Cc1c(C(=O)OC2CCCCC2)sc2ncnc(Nc3ccc([As](=O)(O)O)cc3)c12 |
| InChI | InChI=1S/C20H22AsN3O5S/c1-12-16-18(24-14-9-7-13(8-10-14)21(26,27)28)22-11-23-19(16)30-17(12)20(25)29-15-5-3-2-4-6-15/h7-11,15H,2-6H2,1H3,(H,22,23,24)(H2,26,27,28) |
| InChIKey | PANIFPHHIMIJRV-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 121.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|