C20H22N4O4S2 — CID 21011150
cyclohexyl 5-methyl-4-(4-sulfamoylanilino)thieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 21011150) has the molecular formula C20H22N4O4S2 and a molecular weight of 446.55 g/mol. Its IUPAC name is cyclohexyl 5-methyl-4-(4-sulfamoylanilino)thieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | cyclohexyl 5-methyl-4-(4-sulfamoylanilino)thieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 21011150 |
| Molecular Formula | C20H22N4O4S2 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | cyclohexyl 5-methyl-4-(4-sulfamoylanilino)thieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | Cc1c(C(=O)OC2CCCCC2)sc2ncnc(Nc3ccc(S(N)(=O)=O)cc3)c12 |
| InChI | InChI=1S/C20H22N4O4S2/c1-12-16-18(24-13-7-9-15(10-8-13)30(21,26)27)22-11-23-19(16)29-17(12)20(25)28-14-5-3-2-4-6-14/h7-11,14H,2-6H2,1H3,(H2,21,26,27)(H,22,23,24) |
| InChIKey | HHVWFEUNSVFILI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |