C25H31N3O — CID 29088331
(3S)-N-ethyl-1-[(2-methoxynaphthalen-1-yl)methyl]-N-(pyridin-4-ylmethyl)piperidin-3-amine (PubChem CID 29088331) has the molecular formula C25H31N3O and a molecular weight of 389.54 g/mol. Its IUPAC name is (3S)-N-ethyl-1-[(2-methoxynaphthalen-1-yl)methyl]-N-(pyridin-4-ylmethyl)piperidin-3-amine.
| Compound Name | (3S)-N-ethyl-1-[(2-methoxynaphthalen-1-yl)methyl]-N-(pyridin-4-ylmethyl)piperidin-3-amine |
|---|---|
| PubChem CID | 29088331 |
| Molecular Formula | C25H31N3O |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | (3S)-N-ethyl-1-[(2-methoxynaphthalen-1-yl)methyl]-N-(pyridin-4-ylmethyl)piperidin-3-amine |
| SMILES | CCN(Cc1ccncc1)[C@H]1CCCN(Cc2c(OC)ccc3ccccc23)C1 |
| InChI | InChI=1S/C25H31N3O/c1-3-28(17-20-12-14-26-15-13-20)22-8-6-16-27(18-22)19-24-23-9-5-4-7-21(23)10-11-25(24)29-2/h4-5,7,9-15,22H,3,6,8,16-19H2,1-2H3/t22-/m0/s1 |
| InChIKey | FXHXNJTXTZZEPO-QFIPXVFZSA-N |
| XLogP | 4.73 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |