C21H33N5 — CID 45190430
N-ethyl-1-[(3-methyl-1-propylpyrazol-4-yl)methyl]-N-(pyridin-4-ylmethyl)piperidin-3-amine (PubChem CID 45190430) has the molecular formula C21H33N5 and a molecular weight of 355.53 g/mol. Its IUPAC name is N-ethyl-1-[(3-methyl-1-propylpyrazol-4-yl)methyl]-N-(pyridin-4-ylmethyl)piperidin-3-amine.
| Compound Name | N-ethyl-1-[(3-methyl-1-propylpyrazol-4-yl)methyl]-N-(pyridin-4-ylmethyl)piperidin-3-amine |
|---|---|
| PubChem CID | 45190430 |
| Molecular Formula | C21H33N5 |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.27 |
| IUPAC Name | N-ethyl-1-[(3-methyl-1-propylpyrazol-4-yl)methyl]-N-(pyridin-4-ylmethyl)piperidin-3-amine |
| SMILES | CCCn1cc(CN2CCCC(N(CC)Cc3ccncc3)C2)c(C)n1 |
| InChI | InChI=1S/C21H33N5/c1-4-12-26-16-20(18(3)23-26)15-24-13-6-7-21(17-24)25(5-2)14-19-8-10-22-11-9-19/h8-11,16,21H,4-7,12-15,17H2,1-3H3 |
| InChIKey | NBRHBFKUGOFMRJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |