C24H37N5O — CID 45217219
1-(2-methoxyphenyl)-4-[1-[(3-methyl-1-propylpyrazol-4-yl)methyl]piperidin-3-yl]piperazine (PubChem CID 45217219) has the molecular formula C24H37N5O and a molecular weight of 411.59 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-4-[1-[(3-methyl-1-propylpyrazol-4-yl)methyl]piperidin-3-yl]piperazine.
| Compound Name | 1-(2-methoxyphenyl)-4-[1-[(3-methyl-1-propylpyrazol-4-yl)methyl]piperidin-3-yl]piperazine |
|---|---|
| PubChem CID | 45217219 |
| Molecular Formula | C24H37N5O |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.30 |
| IUPAC Name | 1-(2-methoxyphenyl)-4-[1-[(3-methyl-1-propylpyrazol-4-yl)methyl]piperidin-3-yl]piperazine |
| SMILES | CCCn1cc(CN2CCCC(N3CCN(c4ccccc4OC)CC3)C2)c(C)n1 |
| InChI | InChI=1S/C24H37N5O/c1-4-11-29-18-21(20(2)25-29)17-26-12-7-8-22(19-26)27-13-15-28(16-14-27)23-9-5-6-10-24(23)30-3/h5-6,9-10,18,22H,4,7-8,11-17,19H2,1-3H3 |
| InChIKey | QKPRTRSBJFHTIM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 36.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |