C17H14F3N3O3S — CID 29090293
7-(furan-2-yl)-1-[[(2S)-oxolan-2-yl]methyl]-2-sulfanylidene-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one (PubChem CID 29090293) has the molecular formula C17H14F3N3O3S and a molecular weight of 397.38 g/mol. Its IUPAC name is 7-(furan-2-yl)-1-[[(2S)-oxolan-2-yl]methyl]-2-sulfanylidene-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 7-(furan-2-yl)-1-[[(2S)-oxolan-2-yl]methyl]-2-sulfanylidene-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 29090293 |
| Molecular Formula | C17H14F3N3O3S |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 7-(furan-2-yl)-1-[[(2S)-oxolan-2-yl]methyl]-2-sulfanylidene-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)n(C[C@@H]2CCCO2)c2nc(-c3ccco3)cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C17H14F3N3O3S/c18-17(19,20)10-7-11(12-4-2-6-26-12)21-14-13(10)15(24)22-16(27)23(14)8-9-3-1-5-25-9/h2,4,6-7,9H,1,3,5,8H2,(H,22,24,27)/t9-/m0/s1 |
| InChIKey | OZIUYTPCAIEDNX-VIFPVBQESA-N |
| XLogP | 3.91 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|