C19H15F4N3O2S — CID 44823519
7-(4-fluorophenyl)-1-(oxolan-2-ylmethyl)-2-sulfanylidene-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one (PubChem CID 44823519) has the molecular formula C19H15F4N3O2S and a molecular weight of 425.41 g/mol. Its IUPAC name is 7-(4-fluorophenyl)-1-(oxolan-2-ylmethyl)-2-sulfanylidene-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 7-(4-fluorophenyl)-1-(oxolan-2-ylmethyl)-2-sulfanylidene-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 44823519 |
| Molecular Formula | C19H15F4N3O2S |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 7-(4-fluorophenyl)-1-(oxolan-2-ylmethyl)-2-sulfanylidene-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)n(CC2CCCO2)c2nc(-c3ccc(F)cc3)cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C19H15F4N3O2S/c20-11-5-3-10(4-6-11)14-8-13(19(21,22)23)15-16(24-14)26(18(29)25-17(15)27)9-12-2-1-7-28-12/h3-6,8,12H,1-2,7,9H2,(H,25,27,29) |
| InChIKey | TTYFHCVEHWBDLG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|