C20H20F3N3OS — CID 51854426
1-[(2S)-butan-2-yl]-7-(4-ethylphenyl)-2-sulfanylidene-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one (PubChem CID 51854426) has the molecular formula C20H20F3N3OS and a molecular weight of 407.46 g/mol. Its IUPAC name is 1-[(2S)-butan-2-yl]-7-(4-ethylphenyl)-2-sulfanylidene-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 1-[(2S)-butan-2-yl]-7-(4-ethylphenyl)-2-sulfanylidene-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 51854426 |
| Molecular Formula | C20H20F3N3OS |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 1-[(2S)-butan-2-yl]-7-(4-ethylphenyl)-2-sulfanylidene-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one |
| SMILES | CCc1ccc(-c2cc(C(F)(F)F)c3c(=O)[nH]c(=S)n([C@@H](C)CC)c3n2)cc1 |
| InChI | InChI=1S/C20H20F3N3OS/c1-4-11(3)26-17-16(18(27)25-19(26)28)14(20(21,22)23)10-15(24-17)13-8-6-12(5-2)7-9-13/h6-11H,4-5H2,1-3H3,(H,25,27,28)/t11-/m0/s1 |
| InChIKey | BZVQPPFSRGDYNV-NSHDSACASA-N |
| XLogP | 5.67 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|