C16H14F3N3OS2 — CID 29090549
1-[(2R)-butan-2-yl]-2-sulfanylidene-7-thiophen-2-yl-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one (PubChem CID 29090549) has the molecular formula C16H14F3N3OS2 and a molecular weight of 385.44 g/mol. Its IUPAC name is 1-[(2R)-butan-2-yl]-2-sulfanylidene-7-thiophen-2-yl-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 1-[(2R)-butan-2-yl]-2-sulfanylidene-7-thiophen-2-yl-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 29090549 |
| Molecular Formula | C16H14F3N3OS2 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 1-[(2R)-butan-2-yl]-2-sulfanylidene-7-thiophen-2-yl-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-4-one |
| SMILES | CC[C@@H](C)n1c(=S)[nH]c(=O)c2c(C(F)(F)F)cc(-c3cccs3)nc21 |
| InChI | InChI=1S/C16H14F3N3OS2/c1-3-8(2)22-13-12(14(23)21-15(22)24)9(16(17,18)19)7-10(20-13)11-5-4-6-25-11/h4-8H,3H2,1-2H3,(H,21,23,24)/t8-/m1/s1 |
| InChIKey | QKXGYHMRHPBUED-MRVPVSSYSA-N |
| XLogP | 5.17 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|