C13H9F2N3OS2 — CID 29090691
5-(difluoromethyl)-1-methyl-2-sulfanylidene-7-thiophen-2-ylpyrido[2,3-d]pyrimidin-4-one (PubChem CID 29090691) has the molecular formula C13H9F2N3OS2 and a molecular weight of 325.37 g/mol. Its IUPAC name is 5-(difluoromethyl)-1-methyl-2-sulfanylidene-7-thiophen-2-ylpyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(difluoromethyl)-1-methyl-2-sulfanylidene-7-thiophen-2-ylpyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 29090691 |
| Molecular Formula | C13H9F2N3OS2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 5-(difluoromethyl)-1-methyl-2-sulfanylidene-7-thiophen-2-ylpyrido[2,3-d]pyrimidin-4-one |
| SMILES | Cn1c(=S)[nH]c(=O)c2c(C(F)F)cc(-c3cccs3)nc21 |
| InChI | InChI=1S/C13H9F2N3OS2/c1-18-11-9(12(19)17-13(18)20)6(10(14)15)5-7(16-11)8-3-2-4-21-8/h2-5,10H,1H3,(H,17,19,20) |
| InChIKey | PBYYQJNVFRQLOG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|