C13H15F2N3OS — CID 29090538
1-[(2S)-butan-2-yl]-5-(difluoromethyl)-7-methyl-2-sulfanylidenepyrido[2,3-d]pyrimidin-4-one (PubChem CID 29090538) has the molecular formula C13H15F2N3OS and a molecular weight of 299.35 g/mol. Its IUPAC name is 1-[(2S)-butan-2-yl]-5-(difluoromethyl)-7-methyl-2-sulfanylidenepyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 1-[(2S)-butan-2-yl]-5-(difluoromethyl)-7-methyl-2-sulfanylidenepyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 29090538 |
| Molecular Formula | C13H15F2N3OS |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 1-[(2S)-butan-2-yl]-5-(difluoromethyl)-7-methyl-2-sulfanylidenepyrido[2,3-d]pyrimidin-4-one |
| SMILES | CC[C@H](C)n1c(=S)[nH]c(=O)c2c(C(F)F)cc(C)nc21 |
| InChI | InChI=1S/C13H15F2N3OS/c1-4-7(3)18-11-9(12(19)17-13(18)20)8(10(14)15)5-6(2)16-11/h5,7,10H,4H2,1-3H3,(H,17,19,20)/t7-/m0/s1 |
| InChIKey | PMZDALLIRGMKPO-ZETCQYMHSA-N |
| XLogP | 3.67 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|