C17H15F2N3O2S — CID 29091431
5-(difluoromethyl)-1-ethyl-7-(3-methoxyphenyl)-2-sulfanylidenepyrido[2,3-d]pyrimidin-4-one (PubChem CID 29091431) has the molecular formula C17H15F2N3O2S and a molecular weight of 363.39 g/mol. Its IUPAC name is 5-(difluoromethyl)-1-ethyl-7-(3-methoxyphenyl)-2-sulfanylidenepyrido[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(difluoromethyl)-1-ethyl-7-(3-methoxyphenyl)-2-sulfanylidenepyrido[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 29091431 |
| Molecular Formula | C17H15F2N3O2S |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 5-(difluoromethyl)-1-ethyl-7-(3-methoxyphenyl)-2-sulfanylidenepyrido[2,3-d]pyrimidin-4-one |
| SMILES | CCn1c(=S)[nH]c(=O)c2c(C(F)F)cc(-c3cccc(OC)c3)nc21 |
| InChI | InChI=1S/C17H15F2N3O2S/c1-3-22-15-13(16(23)21-17(22)25)11(14(18)19)8-12(20-15)9-5-4-6-10(7-9)24-2/h4-8,14H,3H2,1-2H3,(H,21,23,25) |
| InChIKey | WPCBWGYWXSLGMR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|