C18H23ClN6O3S2 — CID 29092936
1-[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]-3-[[(3S)-1-methylsulfonylpiperidine-3-carbonyl]amino]thiourea (PubChem CID 29092936) has the molecular formula C18H23ClN6O3S2 and a molecular weight of 471.01 g/mol. Its IUPAC name is 1-[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]-3-[[(3S)-1-methylsulfonylpiperidine-3-carbonyl]amino]thiourea.
| Compound Name | 1-[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]-3-[[(3S)-1-methylsulfonylpiperidine-3-carbonyl]amino]thiourea |
|---|---|
| PubChem CID | 29092936 |
| Molecular Formula | C18H23ClN6O3S2 |
| Molecular Weight | 471.01 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | 1-[1-[(4-chlorophenyl)methyl]pyrazol-4-yl]-3-[[(3S)-1-methylsulfonylpiperidine-3-carbonyl]amino]thiourea |
| SMILES | CS(=O)(=O)N1CCC[C@H](C(=O)NNC(=S)Nc2cnn(Cc3ccc(Cl)cc3)c2)C1 |
| InChI | InChI=1S/C18H23ClN6O3S2/c1-30(27,28)25-8-2-3-14(11-25)17(26)22-23-18(29)21-16-9-20-24(12-16)10-13-4-6-15(19)7-5-13/h4-7,9,12,14H,2-3,8,10-11H2,1H3,(H,22,26)(H2,21,23,29)/t14-/m0/s1 |
| InChIKey | FSIOPXQQXKSWCR-AWEZNQCLSA-N |
| XLogP | 1.57 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.01 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|