C19H25ClN4O3S — CID 51587994
(3S)-N-[3-(4-chlorophenyl)propyl]-1-(1-methylpyrazol-4-yl)sulfonylpiperidine-3-carboxamide (PubChem CID 51587994) has the molecular formula C19H25ClN4O3S and a molecular weight of 424.95 g/mol. Its IUPAC name is (3S)-N-[3-(4-chlorophenyl)propyl]-1-(1-methylpyrazol-4-yl)sulfonylpiperidine-3-carboxamide.
| Compound Name | (3S)-N-[3-(4-chlorophenyl)propyl]-1-(1-methylpyrazol-4-yl)sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 51587994 |
| Molecular Formula | C19H25ClN4O3S |
| Molecular Weight | 424.95 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | (3S)-N-[3-(4-chlorophenyl)propyl]-1-(1-methylpyrazol-4-yl)sulfonylpiperidine-3-carboxamide |
| SMILES | Cn1cc(S(=O)(=O)N2CCC[C@H](C(=O)NCCCc3ccc(Cl)cc3)C2)cn1 |
| InChI | InChI=1S/C19H25ClN4O3S/c1-23-14-18(12-22-23)28(26,27)24-11-3-5-16(13-24)19(25)21-10-2-4-15-6-8-17(20)9-7-15/h6-9,12,14,16H,2-5,10-11,13H2,1H3,(H,21,25)/t16-/m0/s1 |
| InChIKey | SBKGCEZEXXQKQD-INIZCTEOSA-N |
| XLogP | 2.22 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.95 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|