C26H32N4O2 — CID 29097819
3-N,5-N-bis(2-tert-butylphenyl)-1-methylpyrazole-3,5-dicarboxamide (PubChem CID 29097819) has the molecular formula C26H32N4O2 and a molecular weight of 432.57 g/mol. Its IUPAC name is 3-N,5-N-bis(2-tert-butylphenyl)-1-methylpyrazole-3,5-dicarboxamide.
| Compound Name | 3-N,5-N-bis(2-tert-butylphenyl)-1-methylpyrazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 29097819 |
| Molecular Formula | C26H32N4O2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | 3-N,5-N-bis(2-tert-butylphenyl)-1-methylpyrazole-3,5-dicarboxamide |
| SMILES | Cn1nc(C(=O)Nc2ccccc2C(C)(C)C)cc1C(=O)Nc1ccccc1C(C)(C)C |
| InChI | InChI=1S/C26H32N4O2/c1-25(2,3)17-12-8-10-14-19(17)27-23(31)21-16-22(30(7)29-21)24(32)28-20-15-11-9-13-18(20)26(4,5)6/h8-16H,1-7H3,(H,27,31)(H,28,32) |
| InChIKey | VSNMYJPTTDSFGD-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |