C22H22ClN3O3 — CID 29102993
ethyl (4S,5R)-4-(3-chlorophenyl)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-6-oxo-4,5-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 29102993) has the molecular formula C22H22ClN3O3 and a molecular weight of 411.89 g/mol. Its IUPAC name is ethyl (4S,5R)-4-(3-chlorophenyl)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-6-oxo-4,5-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4S,5R)-4-(3-chlorophenyl)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-6-oxo-4,5-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 29102993 |
| Molecular Formula | C22H22ClN3O3 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | ethyl (4S,5R)-4-(3-chlorophenyl)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-6-oxo-4,5-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)NC(N2CCc3ccccc3C2)=N[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H22ClN3O3/c1-2-29-21(28)18-19(15-8-5-9-17(23)12-15)24-22(25-20(18)27)26-11-10-14-6-3-4-7-16(14)13-26/h3-9,12,18-19H,2,10-11,13H2,1H3,(H,24,25,27)/t18-,19-/m1/s1 |
| InChIKey | XSFXNOYACYLDOM-RTBURBONSA-N |
| XLogP | 3.10 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|