C30H31ClN4O3 — CID 29160009
ethyl (4S,5S)-2-(4-benzhydrylpiperazin-1-yl)-4-(3-chlorophenyl)-6-oxo-4,5-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 29160009) has the molecular formula C30H31ClN4O3 and a molecular weight of 531.06 g/mol. Its IUPAC name is ethyl (4S,5S)-2-(4-benzhydrylpiperazin-1-yl)-4-(3-chlorophenyl)-6-oxo-4,5-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4S,5S)-2-(4-benzhydrylpiperazin-1-yl)-4-(3-chlorophenyl)-6-oxo-4,5-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 29160009 |
| Molecular Formula | C30H31ClN4O3 |
| Molecular Weight | 531.06 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | ethyl (4S,5S)-2-(4-benzhydrylpiperazin-1-yl)-4-(3-chlorophenyl)-6-oxo-4,5-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)NC(N2CCN(C(c3ccccc3)c3ccccc3)CC2)=N[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C30H31ClN4O3/c1-2-38-29(37)25-26(23-14-9-15-24(31)20-23)32-30(33-28(25)36)35-18-16-34(17-19-35)27(21-10-5-3-6-11-21)22-12-7-4-8-13-22/h3-15,20,25-27H,2,16-19H2,1H3,(H,32,33,36)/t25-,26+/m0/s1 |
| InChIKey | FFAVEONRTMZKMS-IZZNHLLZSA-N |
| XLogP | 4.45 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.06 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|