About 1-methyl-N-[2-[(2R,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]ethyl]piperidin-4-amine
1-methyl-N-[2-[(2R,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]ethyl]piperidin-4-amine (PubChem CID 29105403) has the molecular formula C21H42N2O
and a molecular weight of 338.58 g/mol. Its IUPAC name is 1-methyl-N-[2-[(2R,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]ethyl]piperidin-4-amine.
Molecular Properties
| Compound Name | 1-methyl-N-[2-[(2R,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]ethyl]piperidin-4-amine |
| PubChem CID | 29105403 |
| Molecular Formula | C21H42N2O |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.33 |
| IUPAC Name | 1-methyl-N-[2-[(2R,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]ethyl]piperidin-4-amine |
| SMILES | CC(C)CC[C@@]1(CCNC2CCN(C)CC2)CCO[C@@H](C(C)C)C1 |
| InChI | InChI=1S/C21H42N2O/c1-17(2)6-9-21(11-15-24-20(16-21)18(3)4)10-12-22-19-7-13-23(5)14-8-19/h17-20,22H,6-16H2,1-5H3/t20-,21-/m1/s1 |
| InChIKey | UOPPJLUPPAPMDX-NHCUHLMSSA-N |
| XLogP | 4.32 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-N-[2-[(2R,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]ethyl]piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N-[2-[(2R,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]ethyl]piperidin-4-amine?
The IUPAC name of 1-methyl-N-[2-[(2R,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]ethyl]piperidin-4-amine (CID 29105403) is 1-methyl-N-[2-[(2R,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]ethyl]piperidin-4-amine.
What is the SMILES notation for 1-methyl-N-[2-[(2R,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]ethyl]piperidin-4-amine?
The canonical SMILES for 1-methyl-N-[2-[(2R,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]ethyl]piperidin-4-amine is CC(C)CC[C@@]1(CCNC2CCN(C)CC2)CCO[C@@H](C(C)C)C1.
What is the InChIKey of 1-methyl-N-[2-[(2R,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]ethyl]piperidin-4-amine?
The InChIKey is UOPPJLUPPAPMDX-NHCUHLMSSA-N. The full InChI is InChI=1S/C21H42N2O/c1-17(2)6-9-21(11-15-24-20(16-21)18(3)4)10-12-22-19-7-13-23(5)14-8-19/h17-20,22H,6-16H2,1-5H3/t20-,21-/m1/s1.
What are the key properties of 1-methyl-N-[2-[(2R,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]ethyl]piperidin-4-amine?
1-methyl-N-[2-[(2R,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]ethyl]piperidin-4-amine has a molecular weight of 338.58 g/mol, XLogP of 4.32, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N-[2-[(2R,4R)-4-(3-methylbutyl)-2-propan-2-yloxan-4-yl]ethyl]piperidin-4-amine is sourced from PubChem (CID 29105403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).