C27H19NO5S — CID 2911012
[2-[[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] naphthalene-2-sulfonate (PubChem CID 2911012) has the molecular formula C27H19NO5S and a molecular weight of 469.52 g/mol. Its IUPAC name is [2-[[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] naphthalene-2-sulfonate.
| Compound Name | [2-[[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 2911012 |
| Molecular Formula | C27H19NO5S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | [2-[[2-(4-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] naphthalene-2-sulfonate |
| SMILES | Cc1ccc(C2=NC(=Cc3ccccc3OS(=O)(=O)c3ccc4ccccc4c3)C(=O)O2)cc1 |
| InChI | InChI=1S/C27H19NO5S/c1-18-10-12-20(13-11-18)26-28-24(27(29)32-26)17-22-8-4-5-9-25(22)33-34(30,31)23-15-14-19-6-2-3-7-21(19)16-23/h2-17H,1H3 |
| InChIKey | HBFPREOQBJJXGH-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|