C24H19NO6S — CID 2935319
[2-[[2-(2-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-methoxybenzenesulfonate (PubChem CID 2935319) has the molecular formula C24H19NO6S and a molecular weight of 449.48 g/mol. Its IUPAC name is [2-[[2-(2-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-methoxybenzenesulfonate.
| Compound Name | [2-[[2-(2-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 2935319 |
| Molecular Formula | C24H19NO6S |
| Molecular Weight | 449.48 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | [2-[[2-(2-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-methoxybenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)Oc2ccccc2C=C2N=C(c3ccccc3C)OC2=O)cc1 |
| InChI | InChI=1S/C24H19NO6S/c1-16-7-3-5-9-20(16)23-25-21(24(26)30-23)15-17-8-4-6-10-22(17)31-32(27,28)19-13-11-18(29-2)12-14-19/h3-15H,1-2H3 |
| InChIKey | PXRVMXKQMWVERT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|