C25H20ClNO6S — CID 2934352
[2-chloro-6-methoxy-4-[[2-(2-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 2934352) has the molecular formula C25H20ClNO6S and a molecular weight of 497.96 g/mol. Its IUPAC name is [2-chloro-6-methoxy-4-[[2-(2-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-chloro-6-methoxy-4-[[2-(2-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 2934352 |
| Molecular Formula | C25H20ClNO6S |
| Molecular Weight | 497.96 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | [2-chloro-6-methoxy-4-[[2-(2-methylphenyl)-5-oxo-1,3-oxazol-4-ylidene]methyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | COc1cc(C=C2N=C(c3ccccc3C)OC2=O)cc(Cl)c1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H20ClNO6S/c1-15-8-10-18(11-9-15)34(29,30)33-23-20(26)12-17(14-22(23)31-3)13-21-25(28)32-24(27-21)19-7-5-4-6-16(19)2/h4-14H,1-3H3 |
| InChIKey | ZVCBXIUQZFYQQS-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.96 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|