C25H29N3O6 — CID 29110811
ethyl (3R,4R)-1-butyl-4-(4-hydroxy-3,5-dimethoxyphenyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate (PubChem CID 29110811) has the molecular formula C25H29N3O6 and a molecular weight of 467.52 g/mol. Its IUPAC name is ethyl (3R,4R)-1-butyl-4-(4-hydroxy-3,5-dimethoxyphenyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate.
| Compound Name | ethyl (3R,4R)-1-butyl-4-(4-hydroxy-3,5-dimethoxyphenyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
|---|---|
| PubChem CID | 29110811 |
| Molecular Formula | C25H29N3O6 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | ethyl (3R,4R)-1-butyl-4-(4-hydroxy-3,5-dimethoxyphenyl)-2-oxo-3,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
| SMILES | CCCCN1C(=O)[C@H](C(=O)OCC)[C@H](c2cc(OC)c(O)c(OC)c2)n2c1nc1ccccc12 |
| InChI | InChI=1S/C25H29N3O6/c1-5-7-12-27-23(30)20(24(31)34-6-2)21(15-13-18(32-3)22(29)19(14-15)33-4)28-17-11-9-8-10-16(17)26-25(27)28/h8-11,13-14,20-21,29H,5-7,12H2,1-4H3/t20-,21+/m1/s1 |
| InChIKey | UDKBLNLGECMRIC-RTWAWAEBSA-N |
| XLogP | 3.67 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|