About (2R)-2-(4-benzo[b][1,4]benzoxazepin-6-ylpiperazin-1-yl)-2-(6-fluoro-1H-indol-3-yl)acetic acid
(2R)-2-(4-benzo[b][1,4]benzoxazepin-6-ylpiperazin-1-yl)-2-(6-fluoro-1H-indol-3-yl)acetic acid (PubChem CID 29128088) has the molecular formula C27H23FN4O3
and a molecular weight of 470.50 g/mol. Its IUPAC name is (2R)-2-(4-benzo[b][1,4]benzoxazepin-6-ylpiperazin-1-yl)-2-(6-fluoro-1H-indol-3-yl)acetic acid.
Molecular Properties
| Compound Name | (2R)-2-(4-benzo[b][1,4]benzoxazepin-6-ylpiperazin-1-yl)-2-(6-fluoro-1H-indol-3-yl)acetic acid |
| PubChem CID | 29128088 |
| Molecular Formula | C27H23FN4O3 |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | (2R)-2-(4-benzo[b][1,4]benzoxazepin-6-ylpiperazin-1-yl)-2-(6-fluoro-1H-indol-3-yl)acetic acid |
| SMILES | O=C(O)[C@@H](c1c[nH]c2cc(F)ccc12)N1CCN(C2=Nc3ccccc3Oc3ccccc32)CC1 |
| InChI | InChI=1S/C27H23FN4O3/c28-17-9-10-18-20(16-29-22(18)15-17)25(27(33)34)31-11-13-32(14-12-31)26-19-5-1-3-7-23(19)35-24-8-4-2-6-21(24)30-26/h1-10,15-16,25,29H,11-14H2,(H,33,34)/t25-/m1/s1 |
| InChIKey | MOJDTBMUFXALKI-RUZDIDTESA-N |
| XLogP | 4.93 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-2-(4-benzo[b][1,4]benzoxazepin-6-ylpiperazin-1-yl)-2-(6-fluoro-1H-indol-3-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(4-benzo[b][1,4]benzoxazepin-6-ylpiperazin-1-yl)-2-(6-fluoro-1H-indol-3-yl)acetic acid?
The IUPAC name of (2R)-2-(4-benzo[b][1,4]benzoxazepin-6-ylpiperazin-1-yl)-2-(6-fluoro-1H-indol-3-yl)acetic acid (CID 29128088) is (2R)-2-(4-benzo[b][1,4]benzoxazepin-6-ylpiperazin-1-yl)-2-(6-fluoro-1H-indol-3-yl)acetic acid.
What is the SMILES notation for (2R)-2-(4-benzo[b][1,4]benzoxazepin-6-ylpiperazin-1-yl)-2-(6-fluoro-1H-indol-3-yl)acetic acid?
The canonical SMILES for (2R)-2-(4-benzo[b][1,4]benzoxazepin-6-ylpiperazin-1-yl)-2-(6-fluoro-1H-indol-3-yl)acetic acid is O=C(O)[C@@H](c1c[nH]c2cc(F)ccc12)N1CCN(C2=Nc3ccccc3Oc3ccccc32)CC1.
What is the InChIKey of (2R)-2-(4-benzo[b][1,4]benzoxazepin-6-ylpiperazin-1-yl)-2-(6-fluoro-1H-indol-3-yl)acetic acid?
The InChIKey is MOJDTBMUFXALKI-RUZDIDTESA-N. The full InChI is InChI=1S/C27H23FN4O3/c28-17-9-10-18-20(16-29-22(18)15-17)25(27(33)34)31-11-13-32(14-12-31)26-19-5-1-3-7-23(19)35-24-8-4-2-6-21(24)30-26/h1-10,15-16,25,29H,11-14H2,(H,33,34)/t25-/m1/s1.
What are the key properties of (2R)-2-(4-benzo[b][1,4]benzoxazepin-6-ylpiperazin-1-yl)-2-(6-fluoro-1H-indol-3-yl)acetic acid?
(2R)-2-(4-benzo[b][1,4]benzoxazepin-6-ylpiperazin-1-yl)-2-(6-fluoro-1H-indol-3-yl)acetic acid has a molecular weight of 470.50 g/mol, XLogP of 4.93, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(4-benzo[b][1,4]benzoxazepin-6-ylpiperazin-1-yl)-2-(6-fluoro-1H-indol-3-yl)acetic acid is sourced from PubChem (CID 29128088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).