C20H21BrN4O2 — CID 29128305
(2R)-2-(5-bromo-1H-indol-3-yl)-2-[4-(pyridin-3-ylmethyl)piperazin-1-yl]acetic acid (PubChem CID 29128305) has the molecular formula C20H21BrN4O2 and a molecular weight of 429.32 g/mol. Its IUPAC name is (2R)-2-(5-bromo-1H-indol-3-yl)-2-[4-(pyridin-3-ylmethyl)piperazin-1-yl]acetic acid.
| Compound Name | (2R)-2-(5-bromo-1H-indol-3-yl)-2-[4-(pyridin-3-ylmethyl)piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 29128305 |
| Molecular Formula | C20H21BrN4O2 |
| Molecular Weight | 429.32 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | (2R)-2-(5-bromo-1H-indol-3-yl)-2-[4-(pyridin-3-ylmethyl)piperazin-1-yl]acetic acid |
| SMILES | O=C(O)[C@@H](c1c[nH]c2ccc(Br)cc12)N1CCN(Cc2cccnc2)CC1 |
| InChI | InChI=1S/C20H21BrN4O2/c21-15-3-4-18-16(10-15)17(12-23-18)19(20(26)27)25-8-6-24(7-9-25)13-14-2-1-5-22-11-14/h1-5,10-12,19,23H,6-9,13H2,(H,26,27)/t19-/m1/s1 |
| InChIKey | GIGYWLACKIARPX-LJQANCHMSA-N |
| XLogP | 3.27 |
| TPSA | 72.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |