C21H24N4O3 — CID 29131018
(2R)-2-(5-methoxy-1H-indol-3-yl)-2-[4-(pyridin-4-ylmethyl)piperazin-1-yl]acetic acid (PubChem CID 29131018) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is (2R)-2-(5-methoxy-1H-indol-3-yl)-2-[4-(pyridin-4-ylmethyl)piperazin-1-yl]acetic acid.
| Compound Name | (2R)-2-(5-methoxy-1H-indol-3-yl)-2-[4-(pyridin-4-ylmethyl)piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 29131018 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (2R)-2-(5-methoxy-1H-indol-3-yl)-2-[4-(pyridin-4-ylmethyl)piperazin-1-yl]acetic acid |
| SMILES | COc1ccc2[nH]cc([C@H](C(=O)O)N3CCN(Cc4ccncc4)CC3)c2c1 |
| InChI | InChI=1S/C21H24N4O3/c1-28-16-2-3-19-17(12-16)18(13-23-19)20(21(26)27)25-10-8-24(9-11-25)14-15-4-6-22-7-5-15/h2-7,12-13,20,23H,8-11,14H2,1H3,(H,26,27)/t20-/m1/s1 |
| InChIKey | YLLJRNOCGFVBGN-HXUWFJFHSA-N |
| XLogP | 2.52 |
| TPSA | 81.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |