C22H25N3O4 — CID 29131719
(2R)-2-(5-methoxy-1H-indol-3-yl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]acetic acid (PubChem CID 29131719) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is (2R)-2-(5-methoxy-1H-indol-3-yl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]acetic acid.
| Compound Name | (2R)-2-(5-methoxy-1H-indol-3-yl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 29131719 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | (2R)-2-(5-methoxy-1H-indol-3-yl)-2-[4-(2-methoxyphenyl)piperazin-1-yl]acetic acid |
| SMILES | COc1ccc2[nH]cc([C@H](C(=O)O)N3CCN(c4ccccc4OC)CC3)c2c1 |
| InChI | InChI=1S/C22H25N3O4/c1-28-15-7-8-18-16(13-15)17(14-23-18)21(22(26)27)25-11-9-24(10-12-25)19-5-3-4-6-20(19)29-2/h3-8,13-14,21,23H,9-12H2,1-2H3,(H,26,27)/t21-/m1/s1 |
| InChIKey | VVWJUGIOSRQPSM-OAQYLSRUSA-N |
| XLogP | 3.13 |
| TPSA | 78.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |