C23H26N2O3 — CID 42651859
2-(4-benzylpiperidin-1-yl)-2-(5-methoxy-1H-indol-3-yl)acetic acid (PubChem CID 42651859) has the molecular formula C23H26N2O3 and a molecular weight of 378.47 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-2-(5-methoxy-1H-indol-3-yl)acetic acid.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-2-(5-methoxy-1H-indol-3-yl)acetic acid |
|---|---|
| PubChem CID | 42651859 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-2-(5-methoxy-1H-indol-3-yl)acetic acid |
| SMILES | COc1ccc2[nH]cc(C(C(=O)O)N3CCC(Cc4ccccc4)CC3)c2c1 |
| InChI | InChI=1S/C23H26N2O3/c1-28-18-7-8-21-19(14-18)20(15-24-21)22(23(26)27)25-11-9-17(10-12-25)13-16-5-3-2-4-6-16/h2-8,14-15,17,22,24H,9-13H2,1H3,(H,26,27) |
| InChIKey | GACUVMZLEDSSHX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |