C22H23N3O4 — CID 42649300
2-(4-formylpiperazin-1-yl)-2-(5-phenylmethoxy-1H-indol-3-yl)acetic acid (PubChem CID 42649300) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 2-(4-formylpiperazin-1-yl)-2-(5-phenylmethoxy-1H-indol-3-yl)acetic acid.
| Compound Name | 2-(4-formylpiperazin-1-yl)-2-(5-phenylmethoxy-1H-indol-3-yl)acetic acid |
|---|---|
| PubChem CID | 42649300 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 2-(4-formylpiperazin-1-yl)-2-(5-phenylmethoxy-1H-indol-3-yl)acetic acid |
| SMILES | O=CN1CCN(C(C(=O)O)c2c[nH]c3ccc(OCc4ccccc4)cc23)CC1 |
| InChI | InChI=1S/C22H23N3O4/c26-15-24-8-10-25(11-9-24)21(22(27)28)19-13-23-20-7-6-17(12-18(19)20)29-14-16-4-2-1-3-5-16/h1-7,12-13,15,21,23H,8-11,14H2,(H,27,28) |
| InChIKey | LAPMKVQYFDJCJO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 85.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|