C28H29N3O4 — CID 29139650
(2R)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-(6-phenylmethoxy-1H-indol-3-yl)acetic acid (PubChem CID 29139650) has the molecular formula C28H29N3O4 and a molecular weight of 471.56 g/mol. Its IUPAC name is (2R)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-(6-phenylmethoxy-1H-indol-3-yl)acetic acid.
| Compound Name | (2R)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-(6-phenylmethoxy-1H-indol-3-yl)acetic acid |
|---|---|
| PubChem CID | 29139650 |
| Molecular Formula | C28H29N3O4 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | (2R)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-2-(6-phenylmethoxy-1H-indol-3-yl)acetic acid |
| SMILES | COc1ccc(N2CCN([C@@H](C(=O)O)c3c[nH]c4cc(OCc5ccccc5)ccc34)CC2)cc1 |
| InChI | InChI=1S/C28H29N3O4/c1-34-22-9-7-21(8-10-22)30-13-15-31(16-14-30)27(28(32)33)25-18-29-26-17-23(11-12-24(25)26)35-19-20-5-3-2-4-6-20/h2-12,17-18,27,29H,13-16,19H2,1H3,(H,32,33)/t27-/m1/s1 |
| InChIKey | XIDNVBCZOSCQHK-HHHXNRCGSA-N |
| XLogP | 4.70 |
| TPSA | 78.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|