C29H29N3O4 — CID 42534009
(2R)-2-[4-(4-acetylphenyl)piperazin-1-yl]-2-(5-phenylmethoxy-1H-indol-3-yl)acetic acid (PubChem CID 42534009) has the molecular formula C29H29N3O4 and a molecular weight of 483.57 g/mol. Its IUPAC name is (2R)-2-[4-(4-acetylphenyl)piperazin-1-yl]-2-(5-phenylmethoxy-1H-indol-3-yl)acetic acid.
| Compound Name | (2R)-2-[4-(4-acetylphenyl)piperazin-1-yl]-2-(5-phenylmethoxy-1H-indol-3-yl)acetic acid |
|---|---|
| PubChem CID | 42534009 |
| Molecular Formula | C29H29N3O4 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | (2R)-2-[4-(4-acetylphenyl)piperazin-1-yl]-2-(5-phenylmethoxy-1H-indol-3-yl)acetic acid |
| SMILES | CC(=O)c1ccc(N2CCN([C@@H](C(=O)O)c3c[nH]c4ccc(OCc5ccccc5)cc34)CC2)cc1 |
| InChI | InChI=1S/C29H29N3O4/c1-20(33)22-7-9-23(10-8-22)31-13-15-32(16-14-31)28(29(34)35)26-18-30-27-12-11-24(17-25(26)27)36-19-21-5-3-2-4-6-21/h2-12,17-18,28,30H,13-16,19H2,1H3,(H,34,35)/t28-/m1/s1 |
| InChIKey | SDLLPNDNGOFJFV-MUUNZHRXSA-N |
| XLogP | 4.90 |
| TPSA | 85.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |