C23H24N4O4 — CID 51973241
(2S)-2-[5-(cyanomethoxy)-1H-indol-3-yl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]acetic acid (PubChem CID 51973241) has the molecular formula C23H24N4O4 and a molecular weight of 420.47 g/mol. Its IUPAC name is (2S)-2-[5-(cyanomethoxy)-1H-indol-3-yl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]acetic acid.
| Compound Name | (2S)-2-[5-(cyanomethoxy)-1H-indol-3-yl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 51973241 |
| Molecular Formula | C23H24N4O4 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | (2S)-2-[5-(cyanomethoxy)-1H-indol-3-yl]-2-[4-(4-methoxyphenyl)piperazin-1-yl]acetic acid |
| SMILES | COc1ccc(N2CCN([C@H](C(=O)O)c3c[nH]c4ccc(OCC#N)cc34)CC2)cc1 |
| InChI | InChI=1S/C23H24N4O4/c1-30-17-4-2-16(3-5-17)26-9-11-27(12-10-26)22(23(28)29)20-15-25-21-7-6-18(14-19(20)21)31-13-8-24/h2-7,14-15,22,25H,9-13H2,1H3,(H,28,29)/t22-/m0/s1 |
| InChIKey | MPVHYHDCNITKHU-QFIPXVFZSA-N |
| XLogP | 3.03 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|