C20H23N3O3S — CID 42654637
2-(5-methoxy-1H-indol-3-yl)-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]acetic acid (PubChem CID 42654637) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is 2-(5-methoxy-1H-indol-3-yl)-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]acetic acid.
| Compound Name | 2-(5-methoxy-1H-indol-3-yl)-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 42654637 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 2-(5-methoxy-1H-indol-3-yl)-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]acetic acid |
| SMILES | COc1ccc2[nH]cc(C(C(=O)O)N3CCN(Cc4cccs4)CC3)c2c1 |
| InChI | InChI=1S/C20H23N3O3S/c1-26-14-4-5-18-16(11-14)17(12-21-18)19(20(24)25)23-8-6-22(7-9-23)13-15-3-2-10-27-15/h2-5,10-12,19,21H,6-9,13H2,1H3,(H,24,25) |
| InChIKey | JWBAVRLQKVVKDK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |