C21H24N4O3S — CID 42654926
2-(5-acetamido-1H-indol-3-yl)-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]acetic acid (PubChem CID 42654926) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is 2-(5-acetamido-1H-indol-3-yl)-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]acetic acid.
| Compound Name | 2-(5-acetamido-1H-indol-3-yl)-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 42654926 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 2-(5-acetamido-1H-indol-3-yl)-2-[4-(thiophen-2-ylmethyl)piperazin-1-yl]acetic acid |
| SMILES | CC(=O)Nc1ccc2[nH]cc(C(C(=O)O)N3CCN(Cc4cccs4)CC3)c2c1 |
| InChI | InChI=1S/C21H24N4O3S/c1-14(26)23-15-4-5-19-17(11-15)18(12-22-19)20(21(27)28)25-8-6-24(7-9-25)13-16-3-2-10-29-16/h2-5,10-12,20,22H,6-9,13H2,1H3,(H,23,26)(H,27,28) |
| InChIKey | LGSZVSYYZGKEPP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 88.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |