C24H25N5O5 — CID 51720651
(E)-4-[[3-[(S)-carboxy-[4-(pyridin-2-ylmethyl)piperazin-1-yl]methyl]-1H-indol-5-yl]amino]-4-oxobut-2-enoic acid (PubChem CID 51720651) has the molecular formula C24H25N5O5 and a molecular weight of 463.49 g/mol. Its IUPAC name is (E)-4-[[3-[(S)-carboxy-[4-(pyridin-2-ylmethyl)piperazin-1-yl]methyl]-1H-indol-5-yl]amino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[[3-[(S)-carboxy-[4-(pyridin-2-ylmethyl)piperazin-1-yl]methyl]-1H-indol-5-yl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 51720651 |
| Molecular Formula | C24H25N5O5 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | (E)-4-[[3-[(S)-carboxy-[4-(pyridin-2-ylmethyl)piperazin-1-yl]methyl]-1H-indol-5-yl]amino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)Nc1ccc2[nH]cc([C@@H](C(=O)O)N3CCN(Cc4ccccn4)CC3)c2c1 |
| InChI | InChI=1S/C24H25N5O5/c30-21(6-7-22(31)32)27-16-4-5-20-18(13-16)19(14-26-20)23(24(33)34)29-11-9-28(10-12-29)15-17-3-1-2-8-25-17/h1-8,13-14,23,26H,9-12,15H2,(H,27,30)(H,31,32)(H,33,34)/b7-6+/t23-/m0/s1 |
| InChIKey | VDNGLDOCFKOYCC-YQTDCCHMSA-N |
| XLogP | 2.09 |
| TPSA | 138.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|