C24H24N4O5 — CID 39338899
(E)-4-[[3-[(S)-carboxy-(4-phenylpiperazin-1-yl)methyl]-1H-indol-6-yl]amino]-4-oxobut-2-enoic acid (PubChem CID 39338899) has the molecular formula C24H24N4O5 and a molecular weight of 448.48 g/mol. Its IUPAC name is (E)-4-[[3-[(S)-carboxy-(4-phenylpiperazin-1-yl)methyl]-1H-indol-6-yl]amino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[[3-[(S)-carboxy-(4-phenylpiperazin-1-yl)methyl]-1H-indol-6-yl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 39338899 |
| Molecular Formula | C24H24N4O5 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | (E)-4-[[3-[(S)-carboxy-(4-phenylpiperazin-1-yl)methyl]-1H-indol-6-yl]amino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)Nc1ccc2c([C@@H](C(=O)O)N3CCN(c4ccccc4)CC3)c[nH]c2c1 |
| InChI | InChI=1S/C24H24N4O5/c29-21(8-9-22(30)31)26-16-6-7-18-19(15-25-20(18)14-16)23(24(32)33)28-12-10-27(11-13-28)17-4-2-1-3-5-17/h1-9,14-15,23,25H,10-13H2,(H,26,29)(H,30,31)(H,32,33)/b9-8+/t23-/m0/s1 |
| InChIKey | NLRHFKKDRLTNPR-YVSHKSEASA-N |
| XLogP | 2.70 |
| TPSA | 125.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|